C17H26BClN2O2 — CID 87180480
6-chloro-N-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 87180480) has the molecular formula C17H26BClN2O2 and a molecular weight of 336.67 g/mol. Its IUPAC name is 6-chloro-N-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | 6-chloro-N-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 87180480 |
| Molecular Formula | C17H26BClN2O2 |
| Molecular Weight | 336.67 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 6-chloro-N-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | CC1(C)OB(c2cc(Cl)nc(NC3CCCCC3)c2)OC1(C)C |
| InChI | InChI=1S/C17H26BClN2O2/c1-16(2)17(3,4)23-18(22-16)12-10-14(19)21-15(11-12)20-13-8-6-5-7-9-13/h10-11,13H,5-9H2,1-4H3,(H,20,21) |
| InChIKey | OQLWCSYVWSNGNO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.67 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|