C9H4BrF11O4 — CID 87180508
1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl 2-(2-bromoacetyl)oxyacetate (PubChem CID 87180508) has the molecular formula C9H4BrF11O4 and a molecular weight of 465.01 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl 2-(2-bromoacetyl)oxyacetate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl 2-(2-bromoacetyl)oxyacetate |
|---|---|
| PubChem CID | 87180508 |
| Molecular Formula | C9H4BrF11O4 |
| Molecular Weight | 465.01 g/mol |
| Exact Mass | 463.91 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl 2-(2-bromoacetyl)oxyacetate |
| SMILES | O=C(CBr)OCC(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H4BrF11O4/c10-1-3(22)24-2-4(23)25-9(20,21)7(15,16)5(11,12)6(13,14)8(17,18)19/h1-2H2 |
| InChIKey | NODJLDTXPYIWGL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.01 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|