C6H4F2N2 — CID 87180763
(3Z,5Z,7Z)-3,4-difluorodiazocine (PubChem CID 87180763) has the molecular formula C6H4F2N2 and a molecular weight of 142.11 g/mol. Its IUPAC name is (3Z,5Z,7Z)-3,4-difluorodiazocine.
| Compound Name | (3Z,5Z,7Z)-3,4-difluorodiazocine |
|---|---|
| PubChem CID | 87180763 |
| Molecular Formula | C6H4F2N2 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | (3Z,5Z,7Z)-3,4-difluorodiazocine |
| SMILES | FC1=C(F)/N=N\C=C/C=C\1 |
| InChI | InChI=1S/C6H4F2N2/c7-5-3-1-2-4-9-10-6(5)8/h1-4H/b2-1-,3-1-,4-2-,5-3+,6-5+,9-4-,10-6+,10-9- |
| InChIKey | VSDPTVGFXJPSDN-ARVIQYKNSA-N |
| XLogP | 2.63 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|