C19H27F3N2O2 — CID 87180818
(E)-1-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one (PubChem CID 87180818) has the molecular formula C19H27F3N2O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is (E)-1-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 87180818 |
| Molecular Formula | C19H27F3N2O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (E)-1-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one |
| SMILES | CC1=C(/C=C/C(=O)N2CCCN(C(=O)C(F)(F)F)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C19H27F3N2O2/c1-14-6-4-9-18(2,3)15(14)7-8-16(25)23-10-5-11-24(13-12-23)17(26)19(20,21)22/h7-8H,4-6,9-13H2,1-3H3/b8-7+ |
| InChIKey | ANRVMZHLVYVVPY-BQYQJAHWSA-N |
| XLogP | 3.69 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|