C18H25F3N2O2 — CID 87180950
(E)-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one (PubChem CID 87180950) has the molecular formula C18H25F3N2O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is (E)-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 87180950 |
| Molecular Formula | C18H25F3N2O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | (E)-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one |
| SMILES | CC1=C(/C=C/C(=O)N2CCN(C(=O)C(F)(F)F)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C18H25F3N2O2/c1-13-5-4-8-17(2,3)14(13)6-7-15(24)22-9-11-23(12-10-22)16(25)18(19,20)21/h6-7H,4-5,8-12H2,1-3H3/b7-6+ |
| InChIKey | POXMWCRPIQJCRB-VOTSOKGWSA-N |
| XLogP | 3.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|