C38H41F5O7S2 — CID 87181020
2-(adamantane-1-carbonyloxy)-3-[difluoro(sulfo)methyl]-4,4,4-trifluorobutanoate;(4-tert-butylphenyl)-diphenylsulfanium (PubChem CID 87181020) has the molecular formula C38H41F5O7S2 and a molecular weight of 768.86 g/mol. Its IUPAC name is 2-(adamantane-1-carbonyloxy)-3-[difluoro(sulfo)methyl]-4,4,4-trifluorobutanoate;(4-tert-butylphenyl)-diphenylsulfanium.
| Compound Name | 2-(adamantane-1-carbonyloxy)-3-[difluoro(sulfo)methyl]-4,4,4-trifluorobutanoate;(4-tert-butylphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 87181020 |
| Molecular Formula | C38H41F5O7S2 |
| Molecular Weight | 768.86 g/mol |
| Exact Mass | 768.22 |
| IUPAC Name | 2-(adamantane-1-carbonyloxy)-3-[difluoro(sulfo)methyl]-4,4,4-trifluorobutanoate;(4-tert-butylphenyl)-diphenylsulfanium |
| SMILES | CC(C)(C)c1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=C([O-])C(OC(=O)C12CC3CC(CC(C3)C1)C2)C(C(F)(F)F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C22H23S.C16H19F5O7S/c1-22(2,3)18-14-16-21(17-15-18)23(19-10-6-4-7-11-19)20-12-8-5-9-13-20;17-15(18,19)11(16(20,21)29(25,26)27)10(12(22)23)28-13(24)14-4-7-1-8(5-14)3-9(2-7)6-14/h4-17H,1-3H3;7-11H,1-6H2,(H,22,23)(H,25,26,27)/q+1;/p-1 |
| InChIKey | URZIISCCAHLKPK-UHFFFAOYSA-M |
| XLogP | 7.60 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.86 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|