About CID 87181285
CID 87181285 (PubChem CID 87181285) has the molecular formula C22H19FN4NaO5S
and a molecular weight of 493.47 g/mol.
Molecular Properties
| Compound Name | CID 87181285 |
| PubChem CID | 87181285 |
| Molecular Formula | C22H19FN4NaO5S |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | — |
| SMILES | CNS(=O)(=O)Nc1cccc(Cc2c(C)c3ccc(Oc4ncccn4)cc3oc2=O)c1F.[Na] |
| InChI | InChI=1S/C22H19FN4O5S.Na/c1-13-16-8-7-15(31-22-25-9-4-10-26-22)12-19(16)32-21(28)17(13)11-14-5-3-6-18(20(14)23)27-33(29,30)24-2;/h3-10,12,24,27H,11H2,1-2H3; |
| InChIKey | RHZYUVSOLGFCAL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze CID 87181285 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87181285?
The IUPAC name of CID 87181285 (CID 87181285) is not available.
What is the SMILES notation for CID 87181285?
The canonical SMILES for CID 87181285 is CNS(=O)(=O)Nc1cccc(Cc2c(C)c3ccc(Oc4ncccn4)cc3oc2=O)c1F.[Na].
What is the InChIKey of CID 87181285?
The InChIKey is RHZYUVSOLGFCAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19FN4O5S.Na/c1-13-16-8-7-15(31-22-25-9-4-10-26-22)12-19(16)32-21(28)17(13)11-14-5-3-6-18(20(14)23)27-33(29,30)24-2;/h3-10,12,24,27H,11H2,1-2H3;.
What are the key properties of CID 87181285?
CID 87181285 has a molecular weight of 493.47 g/mol, XLogP of 2.91, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87181285 is sourced from PubChem (CID 87181285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).