About 1-adamantylmethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate
1-adamantylmethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate (PubChem CID 87181407) has the molecular formula C31H32F2O5S2
and a molecular weight of 586.72 g/mol. Its IUPAC name is 1-adamantylmethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate.
Molecular Properties
| Compound Name | 1-adamantylmethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate |
| PubChem CID | 87181407 |
| Molecular Formula | C31H32F2O5S2 |
| Molecular Weight | 586.72 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | 1-adamantylmethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate |
| SMILES | O=C(OCC12CC3CC(CC(C3)C1)C2)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H32F2O5S2/c32-31(33,29(34)37-22-30-19-23-16-24(20-30)18-25(17-23)21-30)40(35,36)38-39(26-10-4-1-5-11-26,27-12-6-2-7-13-27)28-14-8-3-9-15-28/h1-15,23-25H,16-22H2 |
| InChIKey | OHUOSAOPMYZXRH-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.72 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-adamantylmethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantylmethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The IUPAC name of 1-adamantylmethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate (CID 87181407) is 1-adamantylmethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate.
What is the SMILES notation for 1-adamantylmethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The canonical SMILES for 1-adamantylmethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate is O=C(OCC12CC3CC(CC(C3)C1)C2)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-adamantylmethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The InChIKey is OHUOSAOPMYZXRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H32F2O5S2/c32-31(33,29(34)37-22-30-19-23-16-24(20-30)18-25(17-23)21-30)40(35,36)38-39(26-10-4-1-5-11-26,27-12-6-2-7-13-27)28-14-8-3-9-15-28/h1-15,23-25H,16-22H2.
What are the key properties of 1-adamantylmethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
1-adamantylmethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate has a molecular weight of 586.72 g/mol, XLogP of 7.58, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantylmethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate is sourced from PubChem (CID 87181407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).