C7H4F6O — CID 87181989
1,1,3,5,7,7-hexafluorohepta-1,6-dien-4-one (PubChem CID 87181989) has the molecular formula C7H4F6O and a molecular weight of 218.10 g/mol. Its IUPAC name is 1,1,3,5,7,7-hexafluorohepta-1,6-dien-4-one.
| Compound Name | 1,1,3,5,7,7-hexafluorohepta-1,6-dien-4-one |
|---|---|
| PubChem CID | 87181989 |
| Molecular Formula | C7H4F6O |
| Molecular Weight | 218.10 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | 1,1,3,5,7,7-hexafluorohepta-1,6-dien-4-one |
| SMILES | O=C(C(F)C=C(F)F)C(F)C=C(F)F |
| InChI | InChI=1S/C7H4F6O/c8-3(1-5(10)11)7(14)4(9)2-6(12)13/h1-4H |
| InChIKey | FFRACHLQMWVAGV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.10 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |