About 1,3-dimethylcyclopenta-1,3-diene;vanadium(2+);dichloride
1,3-dimethylcyclopenta-1,3-diene;vanadium(2+);dichloride (PubChem CID 87182182) has the molecular formula C7H9Cl2V-
and a molecular weight of 215.00 g/mol. Its IUPAC name is 1,3-dimethylcyclopenta-1,3-diene;vanadium(2+);dichloride.
Molecular Properties
| Compound Name | 1,3-dimethylcyclopenta-1,3-diene;vanadium(2+);dichloride |
| PubChem CID | 87182182 |
| Molecular Formula | C7H9Cl2V- |
| Molecular Weight | 215.00 g/mol |
| Exact Mass | 213.95 |
| IUPAC Name | 1,3-dimethylcyclopenta-1,3-diene;vanadium(2+);dichloride |
| SMILES | CC1=[C-]C(C)=CC1.[Cl-].[Cl-].[V+2] |
| InChI | InChI=1S/C7H9.2ClH.V/c1-6-3-4-7(2)5-6;;;/h3H,4H2,1-2H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | WXMLLSXPFZTXST-UHFFFAOYSA-L |
| XLogP | -3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.00 |
| LogP ≤ 5 | -3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylcyclopenta-1,3-diene;vanadium(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylcyclopenta-1,3-diene;vanadium(2+);dichloride?
The IUPAC name of 1,3-dimethylcyclopenta-1,3-diene;vanadium(2+);dichloride (CID 87182182) is 1,3-dimethylcyclopenta-1,3-diene;vanadium(2+);dichloride.
What is the SMILES notation for 1,3-dimethylcyclopenta-1,3-diene;vanadium(2+);dichloride?
The canonical SMILES for 1,3-dimethylcyclopenta-1,3-diene;vanadium(2+);dichloride is CC1=[C-]C(C)=CC1.[Cl-].[Cl-].[V+2].
What is the InChIKey of 1,3-dimethylcyclopenta-1,3-diene;vanadium(2+);dichloride?
The InChIKey is WXMLLSXPFZTXST-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H9.2ClH.V/c1-6-3-4-7(2)5-6;;;/h3H,4H2,1-2H3;2*1H;/q-1;;;+2/p-2.
What are the key properties of 1,3-dimethylcyclopenta-1,3-diene;vanadium(2+);dichloride?
1,3-dimethylcyclopenta-1,3-diene;vanadium(2+);dichloride has a molecular weight of 215.00 g/mol, XLogP of -3.91, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylcyclopenta-1,3-diene;vanadium(2+);dichloride is sourced from PubChem (CID 87182182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).