C7H4F6N2O2 — CID 87182387
1,1,1,2,2,3-hexafluoro-4-isocyanato-3-(isocyanatomethyl)butane (PubChem CID 87182387) has the molecular formula C7H4F6N2O2 and a molecular weight of 262.11 g/mol. Its IUPAC name is 1,1,1,2,2,3-hexafluoro-4-isocyanato-3-(isocyanatomethyl)butane.
| Compound Name | 1,1,1,2,2,3-hexafluoro-4-isocyanato-3-(isocyanatomethyl)butane |
|---|---|
| PubChem CID | 87182387 |
| Molecular Formula | C7H4F6N2O2 |
| Molecular Weight | 262.11 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 1,1,1,2,2,3-hexafluoro-4-isocyanato-3-(isocyanatomethyl)butane |
| SMILES | O=C=NCC(F)(CN=C=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H4F6N2O2/c8-5(1-14-3-16,2-15-4-17)6(9,10)7(11,12)13/h1-2H2 |
| InChIKey | IGDMXXZYPHVNRY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.11 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|