C18H29N5O4 — CID 87183061
ethyl (3R,4R,5S)-4-acetamido-5-[[amino-(cyanoamino)methylidene]amino]-3-pentan-3-yloxycyclohexene-1-carboxylate (PubChem CID 87183061) has the molecular formula C18H29N5O4 and a molecular weight of 379.46 g/mol. Its IUPAC name is ethyl (3R,4R,5S)-4-acetamido-5-[[amino-(cyanoamino)methylidene]amino]-3-pentan-3-yloxycyclohexene-1-carboxylate.
| Compound Name | ethyl (3R,4R,5S)-4-acetamido-5-[[amino-(cyanoamino)methylidene]amino]-3-pentan-3-yloxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 87183061 |
| Molecular Formula | C18H29N5O4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | ethyl (3R,4R,5S)-4-acetamido-5-[[amino-(cyanoamino)methylidene]amino]-3-pentan-3-yloxycyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](/N=C(\N)NC#N)C1 |
| InChI | InChI=1S/C18H29N5O4/c1-5-13(6-2)27-15-9-12(17(25)26-7-3)8-14(16(15)22-11(4)24)23-18(20)21-10-19/h9,13-16H,5-8H2,1-4H3,(H,22,24)(H3,20,21,23)/t14-,15+,16+/m0/s1 |
| InChIKey | WQCZIXWGGOQHTF-ARFHVFGLSA-N |
| XLogP | 0.71 |
| TPSA | 138.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|