C20H27F3N2O5S — CID 87183535
[2-[1-methyl-3-[(4-pentylphenyl)sulfonylamino]pyrrolidin-3-yl]acetyl] 2,2,2-trifluoroacetate (PubChem CID 87183535) has the molecular formula C20H27F3N2O5S and a molecular weight of 464.51 g/mol. Its IUPAC name is [2-[1-methyl-3-[(4-pentylphenyl)sulfonylamino]pyrrolidin-3-yl]acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[1-methyl-3-[(4-pentylphenyl)sulfonylamino]pyrrolidin-3-yl]acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87183535 |
| Molecular Formula | C20H27F3N2O5S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | [2-[1-methyl-3-[(4-pentylphenyl)sulfonylamino]pyrrolidin-3-yl]acetyl] 2,2,2-trifluoroacetate |
| SMILES | CCCCCc1ccc(S(=O)(=O)NC2(CC(=O)OC(=O)C(F)(F)F)CCN(C)C2)cc1 |
| InChI | InChI=1S/C20H27F3N2O5S/c1-3-4-5-6-15-7-9-16(10-8-15)31(28,29)24-19(11-12-25(2)14-19)13-17(26)30-18(27)20(21,22)23/h7-10,24H,3-6,11-14H2,1-2H3 |
| InChIKey | NSOGFTYGXURNMN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|