About 4-(4-ethynyl-2,5-dimethylimidazol-1-yl)-1-(2-hydroxyethyl)pyridin-2-one
4-(4-ethynyl-2,5-dimethylimidazol-1-yl)-1-(2-hydroxyethyl)pyridin-2-one (PubChem CID 87183626) has the molecular formula C14H15N3O2
and a molecular weight of 257.29 g/mol. Its IUPAC name is 4-(4-ethynyl-2,5-dimethylimidazol-1-yl)-1-(2-hydroxyethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 4-(4-ethynyl-2,5-dimethylimidazol-1-yl)-1-(2-hydroxyethyl)pyridin-2-one |
| PubChem CID | 87183626 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 4-(4-ethynyl-2,5-dimethylimidazol-1-yl)-1-(2-hydroxyethyl)pyridin-2-one |
| SMILES | C#Cc1nc(C)n(-c2ccn(CCO)c(=O)c2)c1C |
| InChI | InChI=1S/C14H15N3O2/c1-4-13-10(2)17(11(3)15-13)12-5-6-16(7-8-18)14(19)9-12/h1,5-6,9,18H,7-8H2,2-3H3 |
| InChIKey | BAPOFVIDOQBYPS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-ethynyl-2,5-dimethylimidazol-1-yl)-1-(2-hydroxyethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-ethynyl-2,5-dimethylimidazol-1-yl)-1-(2-hydroxyethyl)pyridin-2-one?
The IUPAC name of 4-(4-ethynyl-2,5-dimethylimidazol-1-yl)-1-(2-hydroxyethyl)pyridin-2-one (CID 87183626) is 4-(4-ethynyl-2,5-dimethylimidazol-1-yl)-1-(2-hydroxyethyl)pyridin-2-one.
What is the SMILES notation for 4-(4-ethynyl-2,5-dimethylimidazol-1-yl)-1-(2-hydroxyethyl)pyridin-2-one?
The canonical SMILES for 4-(4-ethynyl-2,5-dimethylimidazol-1-yl)-1-(2-hydroxyethyl)pyridin-2-one is C#Cc1nc(C)n(-c2ccn(CCO)c(=O)c2)c1C.
What is the InChIKey of 4-(4-ethynyl-2,5-dimethylimidazol-1-yl)-1-(2-hydroxyethyl)pyridin-2-one?
The InChIKey is BAPOFVIDOQBYPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O2/c1-4-13-10(2)17(11(3)15-13)12-5-6-16(7-8-18)14(19)9-12/h1,5-6,9,18H,7-8H2,2-3H3.
What are the key properties of 4-(4-ethynyl-2,5-dimethylimidazol-1-yl)-1-(2-hydroxyethyl)pyridin-2-one?
4-(4-ethynyl-2,5-dimethylimidazol-1-yl)-1-(2-hydroxyethyl)pyridin-2-one has a molecular weight of 257.29 g/mol, XLogP of 0.62, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethynyl-2,5-dimethylimidazol-1-yl)-1-(2-hydroxyethyl)pyridin-2-one is sourced from PubChem (CID 87183626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).