C21H15Cl4F3N2O4S — CID 87183680
methyl [2-[2-chloro-N-methyl-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]anilino]-2-oxoethyl]sulfanylformate (PubChem CID 87183680) has the molecular formula C21H15Cl4F3N2O4S and a molecular weight of 590.23 g/mol. Its IUPAC name is methyl [2-[2-chloro-N-methyl-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]anilino]-2-oxoethyl]sulfanylformate.
| Compound Name | methyl [2-[2-chloro-N-methyl-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]anilino]-2-oxoethyl]sulfanylformate |
|---|---|
| PubChem CID | 87183680 |
| Molecular Formula | C21H15Cl4F3N2O4S |
| Molecular Weight | 590.23 g/mol |
| Exact Mass | 587.95 |
| IUPAC Name | methyl [2-[2-chloro-N-methyl-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]anilino]-2-oxoethyl]sulfanylformate |
| SMILES | COC(=O)SCC(=O)N(C)c1ccc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)cc1Cl |
| InChI | InChI=1S/C21H15Cl4F3N2O4S/c1-30(17(31)9-35-19(32)33-2)16-4-3-10(5-12(16)22)15-8-20(34-29-15,21(26,27)28)11-6-13(23)18(25)14(24)7-11/h3-7H,8-9H2,1-2H3 |
| InChIKey | FKKAUIDRLMBMLB-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.23 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|