C18H15N3O — CID 87183723
4-(4-ethynyl-2-methylimidazol-1-yl)-1H-pyridin-2-one;2-methylbicyclo[2.2.0]hexa-1,3,5-triene (PubChem CID 87183723) has the molecular formula C18H15N3O and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-(4-ethynyl-2-methylimidazol-1-yl)-1H-pyridin-2-one;2-methylbicyclo[2.2.0]hexa-1,3,5-triene.
| Compound Name | 4-(4-ethynyl-2-methylimidazol-1-yl)-1H-pyridin-2-one;2-methylbicyclo[2.2.0]hexa-1,3,5-triene |
|---|---|
| PubChem CID | 87183723 |
| Molecular Formula | C18H15N3O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 4-(4-ethynyl-2-methylimidazol-1-yl)-1H-pyridin-2-one;2-methylbicyclo[2.2.0]hexa-1,3,5-triene |
| SMILES | C#Cc1cn(-c2cc[nH]c(=O)c2)c(C)n1.Cc1cc2ccc1-2 |
| InChI | InChI=1S/C11H9N3O.C7H6/c1-3-9-7-14(8(2)13-9)10-4-5-12-11(15)6-10;1-5-4-6-2-3-7(5)6/h1,4-7H,2H3,(H,12,15);2-4H,1H3 |
| InChIKey | LWDAWMKDQLMYJY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|