About 1-bromo-4-[(E)-1,2-diphenylethenyl]benzene
1-bromo-4-[(E)-1,2-diphenylethenyl]benzene (PubChem CID 87184231) has the molecular formula C20H15Br
and a molecular weight of 335.24 g/mol. Its IUPAC name is 1-bromo-4-[(E)-1,2-diphenylethenyl]benzene.
Molecular Properties
| Compound Name | 1-bromo-4-[(E)-1,2-diphenylethenyl]benzene |
| PubChem CID | 87184231 |
| Molecular Formula | C20H15Br |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1-bromo-4-[(E)-1,2-diphenylethenyl]benzene |
| SMILES | Brc1ccc(/C(=C/c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15Br/c21-19-13-11-18(12-14-19)20(17-9-5-2-6-10-17)15-16-7-3-1-4-8-16/h1-15H/b20-15+ |
| InChIKey | NFMIZZDZTWPWLM-HMMYKYKNSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-[(E)-1,2-diphenylethenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-[(E)-1,2-diphenylethenyl]benzene?
The IUPAC name of 1-bromo-4-[(E)-1,2-diphenylethenyl]benzene (CID 87184231) is 1-bromo-4-[(E)-1,2-diphenylethenyl]benzene.
What is the SMILES notation for 1-bromo-4-[(E)-1,2-diphenylethenyl]benzene?
The canonical SMILES for 1-bromo-4-[(E)-1,2-diphenylethenyl]benzene is Brc1ccc(/C(=C/c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1-bromo-4-[(E)-1,2-diphenylethenyl]benzene?
The InChIKey is NFMIZZDZTWPWLM-HMMYKYKNSA-N. The full InChI is InChI=1S/C20H15Br/c21-19-13-11-18(12-14-19)20(17-9-5-2-6-10-17)15-16-7-3-1-4-8-16/h1-15H/b20-15+.
What are the key properties of 1-bromo-4-[(E)-1,2-diphenylethenyl]benzene?
1-bromo-4-[(E)-1,2-diphenylethenyl]benzene has a molecular weight of 335.24 g/mol, XLogP of 6.04, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-[(E)-1,2-diphenylethenyl]benzene is sourced from PubChem (CID 87184231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).