C27H25F3N2O4 — CID 87184276
[4-[[[1-(1-benzofuran-2-ylmethyl)-5-(trifluoromethyl)indole-7-carbonyl]amino]methyl]cyclohexyl] formate (PubChem CID 87184276) has the molecular formula C27H25F3N2O4 and a molecular weight of 498.50 g/mol. Its IUPAC name is [4-[[[1-(1-benzofuran-2-ylmethyl)-5-(trifluoromethyl)indole-7-carbonyl]amino]methyl]cyclohexyl] formate.
| Compound Name | [4-[[[1-(1-benzofuran-2-ylmethyl)-5-(trifluoromethyl)indole-7-carbonyl]amino]methyl]cyclohexyl] formate |
|---|---|
| PubChem CID | 87184276 |
| Molecular Formula | C27H25F3N2O4 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | [4-[[[1-(1-benzofuran-2-ylmethyl)-5-(trifluoromethyl)indole-7-carbonyl]amino]methyl]cyclohexyl] formate |
| SMILES | O=COC1CCC(CNC(=O)c2cc(C(F)(F)F)cc3ccn(Cc4cc5ccccc5o4)c23)CC1 |
| InChI | InChI=1S/C27H25F3N2O4/c28-27(29,30)20-11-19-9-10-32(15-22-12-18-3-1-2-4-24(18)36-22)25(19)23(13-20)26(34)31-14-17-5-7-21(8-6-17)35-16-33/h1-4,9-13,16-17,21H,5-8,14-15H2,(H,31,34) |
| InChIKey | KKFYUFCOAYAIRK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|