C25H31FN4O4S — CID 87184473
6-[2-tert-butyl-4-(4-fluorophenyl)-1,3-oxazol-5-yl]-1-(2-methylpropyl)benzimidazol-2-amine;methanesulfonic acid (PubChem CID 87184473) has the molecular formula C25H31FN4O4S and a molecular weight of 502.61 g/mol. Its IUPAC name is 6-[2-tert-butyl-4-(4-fluorophenyl)-1,3-oxazol-5-yl]-1-(2-methylpropyl)benzimidazol-2-amine;methanesulfonic acid.
| Compound Name | 6-[2-tert-butyl-4-(4-fluorophenyl)-1,3-oxazol-5-yl]-1-(2-methylpropyl)benzimidazol-2-amine;methanesulfonic acid |
|---|---|
| PubChem CID | 87184473 |
| Molecular Formula | C25H31FN4O4S |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 6-[2-tert-butyl-4-(4-fluorophenyl)-1,3-oxazol-5-yl]-1-(2-methylpropyl)benzimidazol-2-amine;methanesulfonic acid |
| SMILES | CC(C)Cn1c(N)nc2ccc(-c3oc(C(C)(C)C)nc3-c3ccc(F)cc3)cc21.CS(=O)(=O)O |
| InChI | InChI=1S/C24H27FN4O.CH4O3S/c1-14(2)13-29-19-12-16(8-11-18(19)27-23(29)26)21-20(15-6-9-17(25)10-7-15)28-22(30-21)24(3,4)5;1-5(2,3)4/h6-12,14H,13H2,1-5H3,(H2,26,27);1H3,(H,2,3,4) |
| InChIKey | YIIUPTFUEUFGQZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|