C29H29F5O4 — CID 87184802
(E)-3-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]prop-2-enoic acid (PubChem CID 87184802) has the molecular formula C29H29F5O4 and a molecular weight of 536.54 g/mol. Its IUPAC name is (E)-3-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 87184802 |
| Molecular Formula | C29H29F5O4 |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | (E)-3-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]prop-2-enoic acid |
| SMILES | C[C@]12C[C@H](c3ccc(/C=C/C(=O)O)cc3)C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C29H29F5O4/c1-26-15-22(17-5-2-16(3-6-17)4-11-24(36)37)25-20-10-8-19(35)14-18(20)7-9-21(25)23(26)12-13-27(26,38)28(30,31)29(32,33)34/h2-6,11,14,21-23,38H,7-10,12-13,15H2,1H3,(H,36,37)/b11-4+/t21-,22+,23-,26-,27-/m0/s1 |
| InChIKey | AKTQIRWGWHJAAQ-JVLXXYMWSA-N |
| XLogP | 6.61 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|