C14H22N2O8 — CID 87185138
1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxypropylperoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 87185138) has the molecular formula C14H22N2O8 and a molecular weight of 346.34 g/mol. Its IUPAC name is 1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxypropylperoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxypropylperoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87185138 |
| Molecular Formula | C14H22N2O8 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxypropylperoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COC(C)COOC1C(O)[C@H](CO)O[C@@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H22N2O8/c1-7-4-16(14(20)15-12(7)19)13-11(10(18)9(5-17)23-13)24-22-6-8(2)21-3/h4,8-11,13,17-18H,5-6H2,1-3H3,(H,15,19,20)/t8?,9-,10?,11?,13-/m0/s1 |
| InChIKey | VFNOKYRERUJXKS-ZZIBBXFZSA-N |
| XLogP | -1.55 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|