C20H9ClF10N2O2S — CID 87185805
N-[2-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethylsulfanyl)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide (PubChem CID 87185805) has the molecular formula C20H9ClF10N2O2S and a molecular weight of 566.80 g/mol. Its IUPAC name is N-[2-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethylsulfanyl)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide.
| Compound Name | N-[2-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethylsulfanyl)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide |
|---|---|
| PubChem CID | 87185805 |
| Molecular Formula | C20H9ClF10N2O2S |
| Molecular Weight | 566.80 g/mol |
| Exact Mass | 565.99 |
| IUPAC Name | N-[2-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethylsulfanyl)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide |
| SMILES | O=C(Nc1c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1SC(F)(F)F)c1ccc2ccc[n+]([O-])c2c1 |
| InChI | InChI=1S/C20H9ClF10N2O2S/c21-12-7-11(17(22,18(23,24)25)19(26,27)28)8-14(36-20(29,30)31)15(12)32-16(34)10-4-3-9-2-1-5-33(35)13(9)6-10/h1-8H,(H,32,34) |
| InChIKey | HTGIEFNIKKFQPI-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.80 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|