C21H9F12IN2O3S — CID 87185889
N-[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethylsulfinyl)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide (PubChem CID 87185889) has the molecular formula C21H9F12IN2O3S and a molecular weight of 724.26 g/mol. Its IUPAC name is N-[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethylsulfinyl)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide.
| Compound Name | N-[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethylsulfinyl)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide |
|---|---|
| PubChem CID | 87185889 |
| Molecular Formula | C21H9F12IN2O3S |
| Molecular Weight | 724.26 g/mol |
| Exact Mass | 723.92 |
| IUPAC Name | N-[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethylsulfinyl)phenyl]-1-oxidoquinolin-1-ium-7-carboxamide |
| SMILES | O=C(Nc1c(I)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc1S(=O)C(F)(F)F)c1ccc2ccc[n+]([O-])c2c1 |
| InChI | InChI=1S/C21H9F12IN2O3S/c22-17(19(25,26)27,18(23,24)20(28,29)30)11-7-12(34)15(14(8-11)40(39)21(31,32)33)35-16(37)10-4-3-9-2-1-5-36(38)13(9)6-10/h1-8H,(H,35,37) |
| InChIKey | CQFVFLJAVRFZSB-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.26 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|