About nonylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane)
nonylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane) (PubChem CID 87186209) has the molecular formula C15H30O6P2S2
and a molecular weight of 432.48 g/mol. Its IUPAC name is nonylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane).
Molecular Properties
| Compound Name | nonylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane) |
| PubChem CID | 87186209 |
| Molecular Formula | C15H30O6P2S2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | nonylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane) |
| SMILES | CCCCCCCCCc1ccccc1.OP(O)(O)=S.OP(O)(O)=S |
| InChI | InChI=1S/C15H24.2H3O3PS/c1-2-3-4-5-6-7-9-12-15-13-10-8-11-14-15;2*1-4(2,3)5/h8,10-11,13-14H,2-7,9,12H2,1H3;2*(H3,1,2,3,5) |
| InChIKey | NVBSRQXTUHGAHO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze nonylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane)?
The IUPAC name of nonylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane) (CID 87186209) is nonylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane).
What is the SMILES notation for nonylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane)?
The canonical SMILES for nonylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane) is CCCCCCCCCc1ccccc1.OP(O)(O)=S.OP(O)(O)=S.
What is the InChIKey of nonylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane)?
The InChIKey is NVBSRQXTUHGAHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24.2H3O3PS/c1-2-3-4-5-6-7-9-12-15-13-10-8-11-14-15;2*1-4(2,3)5/h8,10-11,13-14H,2-7,9,12H2,1H3;2*(H3,1,2,3,5).
What are the key properties of nonylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane)?
nonylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane) has a molecular weight of 432.48 g/mol, XLogP of 3.36, 8 rotatable bonds, 6 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nonylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane) is sourced from PubChem (CID 87186209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).