C22H37N5O3S2 — CID 87186403
1,1-dicyclohexyl-3-[4-methyl-5-(piperidin-1-ylsulfamoyl)-1,3-thiazol-2-yl]urea (PubChem CID 87186403) has the molecular formula C22H37N5O3S2 and a molecular weight of 483.70 g/mol. Its IUPAC name is 1,1-dicyclohexyl-3-[4-methyl-5-(piperidin-1-ylsulfamoyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1,1-dicyclohexyl-3-[4-methyl-5-(piperidin-1-ylsulfamoyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 87186403 |
| Molecular Formula | C22H37N5O3S2 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 1,1-dicyclohexyl-3-[4-methyl-5-(piperidin-1-ylsulfamoyl)-1,3-thiazol-2-yl]urea |
| SMILES | Cc1nc(NC(=O)N(C2CCCCC2)C2CCCCC2)sc1S(=O)(=O)NN1CCCCC1 |
| InChI | InChI=1S/C22H37N5O3S2/c1-17-20(32(29,30)25-26-15-9-4-10-16-26)31-21(23-17)24-22(28)27(18-11-5-2-6-12-18)19-13-7-3-8-14-19/h18-19,25H,2-16H2,1H3,(H,23,24,28) |
| InChIKey | CZASAUZEDICIKH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |