C21H15F5O4S2 — CID 87186528
2-(4-diphenylsulfoniophenoxy)-1,1,1,3,3-pentafluoropropane-2-sulfonate (PubChem CID 87186528) has the molecular formula C21H15F5O4S2 and a molecular weight of 490.47 g/mol. Its IUPAC name is 2-(4-diphenylsulfoniophenoxy)-1,1,1,3,3-pentafluoropropane-2-sulfonate.
| Compound Name | 2-(4-diphenylsulfoniophenoxy)-1,1,1,3,3-pentafluoropropane-2-sulfonate |
|---|---|
| PubChem CID | 87186528 |
| Molecular Formula | C21H15F5O4S2 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | 2-(4-diphenylsulfoniophenoxy)-1,1,1,3,3-pentafluoropropane-2-sulfonate |
| SMILES | O=S(=O)([O-])C(Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H15F5O4S2/c22-19(23)20(21(24,25)26,32(27,28)29)30-15-11-13-18(14-12-15)31(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,19H |
| InChIKey | GQIVUTHQJAHBKR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|