About 3-fluoro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carboxylic acid
3-fluoro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 87186892) has the molecular formula C7H6FNO5
and a molecular weight of 203.13 g/mol. Its IUPAC name is 3-fluoro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-fluoro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 87186892 |
| Molecular Formula | C7H6FNO5 |
| Molecular Weight | 203.13 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 3-fluoro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C1C=C(F)C=CC1(O)[N+](=O)[O-] |
| InChI | InChI=1S/C7H6FNO5/c8-4-1-2-7(12,9(13)14)5(3-4)6(10)11/h1-3,5,12H,(H,10,11) |
| InChIKey | WAJHJKBMPIAOFA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.13 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 3-fluoro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carboxylic acid (CID 87186892) is 3-fluoro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 3-fluoro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 3-fluoro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carboxylic acid is O=C(O)C1C=C(F)C=CC1(O)[N+](=O)[O-].
What is the InChIKey of 3-fluoro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is WAJHJKBMPIAOFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FNO5/c8-4-1-2-7(12,9(13)14)5(3-4)6(10)11/h1-3,5,12H,(H,10,11).
What are the key properties of 3-fluoro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carboxylic acid?
3-fluoro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 203.13 g/mol, XLogP of 0.08, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 87186892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).