C9H18O6S — CID 87186992
(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-2-propan-2-ylsulfanyloxyhexanal (PubChem CID 87186992) has the molecular formula C9H18O6S and a molecular weight of 254.30 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-2-propan-2-ylsulfanyloxyhexanal.
| Compound Name | (2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-2-propan-2-ylsulfanyloxyhexanal |
|---|---|
| PubChem CID | 87186992 |
| Molecular Formula | C9H18O6S |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-2-propan-2-ylsulfanyloxyhexanal |
| SMILES | CC(C)SO[C@@H](C=O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H18O6S/c1-5(2)16-15-7(4-11)9(14)8(13)6(12)3-10/h4-10,12-14H,3H2,1-2H3/t6-,7+,8+,9-/m1/s1 |
| InChIKey | DJONJZAZFSFHLS-RYPBNFRJSA-N |
| XLogP | -1.30 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|