About chromium;terephthalic acid
chromium;terephthalic acid (PubChem CID 87187082) has the molecular formula C8H6CrO4
and a molecular weight of 218.13 g/mol. Its IUPAC name is chromium;terephthalic acid.
Molecular Properties
| Compound Name | chromium;terephthalic acid |
| PubChem CID | 87187082 |
| Molecular Formula | C8H6CrO4 |
| Molecular Weight | 218.13 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | chromium;terephthalic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)cc1.[Cr] |
| InChI | InChI=1S/C8H6O4.Cr/c9-7(10)5-1-2-6(4-3-5)8(11)12;/h1-4H,(H,9,10)(H,11,12); |
| InChIKey | UXZUOIUTFLXRQS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.13 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze chromium;terephthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium;terephthalic acid?
The IUPAC name of chromium;terephthalic acid (CID 87187082) is chromium;terephthalic acid.
What is the SMILES notation for chromium;terephthalic acid?
The canonical SMILES for chromium;terephthalic acid is O=C(O)c1ccc(C(=O)O)cc1.[Cr].
What is the InChIKey of chromium;terephthalic acid?
The InChIKey is UXZUOIUTFLXRQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.Cr/c9-7(10)5-1-2-6(4-3-5)8(11)12;/h1-4H,(H,9,10)(H,11,12);.
What are the key properties of chromium;terephthalic acid?
chromium;terephthalic acid has a molecular weight of 218.13 g/mol, XLogP of 1.08, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;terephthalic acid is sourced from PubChem (CID 87187082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).