C17H26O4 — CID 87187330
2-(cyclohexylmethyl)-2,3,4-trimethyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid (PubChem CID 87187330) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-2,3,4-trimethyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid.
| Compound Name | 2-(cyclohexylmethyl)-2,3,4-trimethyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 87187330 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 2-(cyclohexylmethyl)-2,3,4-trimethyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid |
| SMILES | CC1CC23OC2(O3)C(C)(CC2CCCCC2)C1(C)C(=O)O |
| InChI | InChI=1S/C17H26O4/c1-11-9-16-17(20-16,21-16)14(2,15(11,3)13(18)19)10-12-7-5-4-6-8-12/h11-12H,4-10H2,1-3H3,(H,18,19) |
| InChIKey | NNWZTIFWESTPAB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 62.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|