C19H17F6N5O3S — CID 87187462
2-[5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyrimidine-5-carboxamide (PubChem CID 87187462) has the molecular formula C19H17F6N5O3S and a molecular weight of 509.43 g/mol. Its IUPAC name is 2-[5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyrimidine-5-carboxamide.
| Compound Name | 2-[5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 87187462 |
| Molecular Formula | C19H17F6N5O3S |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 2-[5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cnc(N2CC3CN(S(=O)(=O)c4cc(C(F)(F)F)cc(C(F)(F)F)c4)CC3C2)nc1 |
| InChI | InChI=1S/C19H17F6N5O3S/c20-18(21,22)13-1-14(19(23,24)25)3-15(2-13)34(32,33)30-8-11-6-29(7-12(11)9-30)17-27-4-10(5-28-17)16(26)31/h1-5,11-12H,6-9H2,(H2,26,31) |
| InChIKey | PJZNJLUUYJWSER-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |