C7H9F5S — CID 87187516
(E)-4,4,5,5,5-pentafluoro-3-methyl-1-methylsulfanylpent-2-ene (PubChem CID 87187516) has the molecular formula C7H9F5S and a molecular weight of 220.21 g/mol. Its IUPAC name is (E)-4,4,5,5,5-pentafluoro-3-methyl-1-methylsulfanylpent-2-ene.
| Compound Name | (E)-4,4,5,5,5-pentafluoro-3-methyl-1-methylsulfanylpent-2-ene |
|---|---|
| PubChem CID | 87187516 |
| Molecular Formula | C7H9F5S |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | (E)-4,4,5,5,5-pentafluoro-3-methyl-1-methylsulfanylpent-2-ene |
| SMILES | CSC/C=C(\C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H9F5S/c1-5(3-4-13-2)6(8,9)7(10,11)12/h3H,4H2,1-2H3/b5-3+ |
| InChIKey | UCVJISBWOLLLIB-HWKANZROSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|