C23H30N8O — CID 87187605
2-[4-[4-[[4-(3-aminopiperidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]acetaldehyde (PubChem CID 87187605) has the molecular formula C23H30N8O and a molecular weight of 434.55 g/mol. Its IUPAC name is 2-[4-[4-[[4-(3-aminopiperidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]acetaldehyde.
| Compound Name | 2-[4-[4-[[4-(3-aminopiperidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 87187605 |
| Molecular Formula | C23H30N8O |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 2-[4-[4-[[4-(3-aminopiperidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]acetaldehyde |
| SMILES | NC1CCCN(c2nc(Nc3ccc(N4CCN(CC=O)CC4)cc3)nc3[nH]ccc23)C1 |
| InChI | InChI=1S/C23H30N8O/c24-17-2-1-9-31(16-17)22-20-7-8-25-21(20)27-23(28-22)26-18-3-5-19(6-4-18)30-12-10-29(11-13-30)14-15-32/h3-8,15,17H,1-2,9-14,16,24H2,(H2,25,26,27,28) |
| InChIKey | HSKACQKCUALJAO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|