C18H16BrN3O3 — CID 87187921
1-[(6-bromo-2-pyridinyl)methyl]-N-(methoxymethyl)-4-oxoquinoline-3-carboxamide (PubChem CID 87187921) has the molecular formula C18H16BrN3O3 and a molecular weight of 402.25 g/mol. Its IUPAC name is 1-[(6-bromo-2-pyridinyl)methyl]-N-(methoxymethyl)-4-oxoquinoline-3-carboxamide.
| Compound Name | 1-[(6-bromo-2-pyridinyl)methyl]-N-(methoxymethyl)-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 87187921 |
| Molecular Formula | C18H16BrN3O3 |
| Molecular Weight | 402.25 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 1-[(6-bromo-2-pyridinyl)methyl]-N-(methoxymethyl)-4-oxoquinoline-3-carboxamide |
| SMILES | COCNC(=O)c1cn(Cc2cccc(Br)n2)c2ccccc2c1=O |
| InChI | InChI=1S/C18H16BrN3O3/c1-25-11-20-18(24)14-10-22(9-12-5-4-8-16(19)21-12)15-7-3-2-6-13(15)17(14)23/h2-8,10H,9,11H2,1H3,(H,20,24) |
| InChIKey | LTKIDOUYFHNNQH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|