C9H23N2O4P — CID 87188891
N',N'-diethyl-N-prop-2-enylethane-1,2-diamine;phosphoric acid (PubChem CID 87188891) has the molecular formula C9H23N2O4P and a molecular weight of 254.27 g/mol. Its IUPAC name is N',N'-diethyl-N-prop-2-enylethane-1,2-diamine;phosphoric acid.
| Compound Name | N',N'-diethyl-N-prop-2-enylethane-1,2-diamine;phosphoric acid |
|---|---|
| PubChem CID | 87188891 |
| Molecular Formula | C9H23N2O4P |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | N',N'-diethyl-N-prop-2-enylethane-1,2-diamine;phosphoric acid |
| SMILES | C=CCNCCN(CC)CC.O=P(O)(O)O |
| InChI | InChI=1S/C9H20N2.H3O4P/c1-4-7-10-8-9-11(5-2)6-3;1-5(2,3)4/h4,10H,1,5-9H2,2-3H3;(H3,1,2,3,4) |
| InChIKey | SDWFTBDFYOBSIU-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|