About 3-hydroxy-3-phenylpyrrolidine-2,5-dione;methanesulfonic acid
3-hydroxy-3-phenylpyrrolidine-2,5-dione;methanesulfonic acid (PubChem CID 87188920) has the molecular formula C11H13NO6S
and a molecular weight of 287.29 g/mol. Its IUPAC name is 3-hydroxy-3-phenylpyrrolidine-2,5-dione;methanesulfonic acid.
Molecular Properties
| Compound Name | 3-hydroxy-3-phenylpyrrolidine-2,5-dione;methanesulfonic acid |
| PubChem CID | 87188920 |
| Molecular Formula | C11H13NO6S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-hydroxy-3-phenylpyrrolidine-2,5-dione;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.O=C1CC(O)(c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C10H9NO3.CH4O3S/c12-8-6-10(14,9(13)11-8)7-4-2-1-3-5-7;1-5(2,3)4/h1-5,14H,6H2,(H,11,12,13);1H3,(H,2,3,4) |
| InChIKey | VKSJTTOMEIOCJH-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-3-phenylpyrrolidine-2,5-dione;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-3-phenylpyrrolidine-2,5-dione;methanesulfonic acid?
The IUPAC name of 3-hydroxy-3-phenylpyrrolidine-2,5-dione;methanesulfonic acid (CID 87188920) is 3-hydroxy-3-phenylpyrrolidine-2,5-dione;methanesulfonic acid.
What is the SMILES notation for 3-hydroxy-3-phenylpyrrolidine-2,5-dione;methanesulfonic acid?
The canonical SMILES for 3-hydroxy-3-phenylpyrrolidine-2,5-dione;methanesulfonic acid is CS(=O)(=O)O.O=C1CC(O)(c2ccccc2)C(=O)N1.
What is the InChIKey of 3-hydroxy-3-phenylpyrrolidine-2,5-dione;methanesulfonic acid?
The InChIKey is VKSJTTOMEIOCJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3.CH4O3S/c12-8-6-10(14,9(13)11-8)7-4-2-1-3-5-7;1-5(2,3)4/h1-5,14H,6H2,(H,11,12,13);1H3,(H,2,3,4).
What are the key properties of 3-hydroxy-3-phenylpyrrolidine-2,5-dione;methanesulfonic acid?
3-hydroxy-3-phenylpyrrolidine-2,5-dione;methanesulfonic acid has a molecular weight of 287.29 g/mol, XLogP of -0.58, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-3-phenylpyrrolidine-2,5-dione;methanesulfonic acid is sourced from PubChem (CID 87188920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).