About (Z,12R)-12-hydroxy-N,N-dimethyloctadec-9-enamide
(Z,12R)-12-hydroxy-N,N-dimethyloctadec-9-enamide (PubChem CID 87189314) has the molecular formula C20H39NO2
and a molecular weight of 325.54 g/mol. Its IUPAC name is (Z,12R)-12-hydroxy-N,N-dimethyloctadec-9-enamide.
Molecular Properties
| Compound Name | (Z,12R)-12-hydroxy-N,N-dimethyloctadec-9-enamide |
| PubChem CID | 87189314 |
| Molecular Formula | C20H39NO2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.30 |
| IUPAC Name | (Z,12R)-12-hydroxy-N,N-dimethyloctadec-9-enamide |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)N(C)C |
| InChI | InChI=1S/C20H39NO2/c1-4-5-6-13-16-19(22)17-14-11-9-7-8-10-12-15-18-20(23)21(2)3/h11,14,19,22H,4-10,12-13,15-18H2,1-3H3/b14-11-/t19-/m1/s1 |
| InChIKey | BKJHWAWYJHTUJU-KWRJMZDGSA-N |
| XLogP | 5.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z,12R)-12-hydroxy-N,N-dimethyloctadec-9-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,12R)-12-hydroxy-N,N-dimethyloctadec-9-enamide?
The IUPAC name of (Z,12R)-12-hydroxy-N,N-dimethyloctadec-9-enamide (CID 87189314) is (Z,12R)-12-hydroxy-N,N-dimethyloctadec-9-enamide.
What is the SMILES notation for (Z,12R)-12-hydroxy-N,N-dimethyloctadec-9-enamide?
The canonical SMILES for (Z,12R)-12-hydroxy-N,N-dimethyloctadec-9-enamide is CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)N(C)C.
What is the InChIKey of (Z,12R)-12-hydroxy-N,N-dimethyloctadec-9-enamide?
The InChIKey is BKJHWAWYJHTUJU-KWRJMZDGSA-N. The full InChI is InChI=1S/C20H39NO2/c1-4-5-6-13-16-19(22)17-14-11-9-7-8-10-12-15-18-20(23)21(2)3/h11,14,19,22H,4-10,12-13,15-18H2,1-3H3/b14-11-/t19-/m1/s1.
What are the key properties of (Z,12R)-12-hydroxy-N,N-dimethyloctadec-9-enamide?
(Z,12R)-12-hydroxy-N,N-dimethyloctadec-9-enamide has a molecular weight of 325.54 g/mol, XLogP of 5.08, 15 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,12R)-12-hydroxy-N,N-dimethyloctadec-9-enamide is sourced from PubChem (CID 87189314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).