About 2-butylhexa-2,4-dienedioic acid
2-butylhexa-2,4-dienedioic acid (PubChem CID 87189753) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-butylhexa-2,4-dienedioic acid.
Molecular Properties
| Compound Name | 2-butylhexa-2,4-dienedioic acid |
| PubChem CID | 87189753 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2-butylhexa-2,4-dienedioic acid |
| SMILES | CCCCC(=CC=CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H14O4/c1-2-3-5-8(10(13)14)6-4-7-9(11)12/h4,6-7H,2-3,5H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | FPTGBNOIIIZSHE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-butylhexa-2,4-dienedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylhexa-2,4-dienedioic acid?
The IUPAC name of 2-butylhexa-2,4-dienedioic acid (CID 87189753) is 2-butylhexa-2,4-dienedioic acid.
What is the SMILES notation for 2-butylhexa-2,4-dienedioic acid?
The canonical SMILES for 2-butylhexa-2,4-dienedioic acid is CCCCC(=CC=CC(=O)O)C(=O)O.
What is the InChIKey of 2-butylhexa-2,4-dienedioic acid?
The InChIKey is FPTGBNOIIIZSHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-2-3-5-8(10(13)14)6-4-7-9(11)12/h4,6-7H,2-3,5H2,1H3,(H,11,12)(H,13,14).
What are the key properties of 2-butylhexa-2,4-dienedioic acid?
2-butylhexa-2,4-dienedioic acid has a molecular weight of 198.22 g/mol, XLogP of 1.83, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylhexa-2,4-dienedioic acid is sourced from PubChem (CID 87189753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).