About 3-fluorobutanamide
3-fluorobutanamide (PubChem CID 87189810) has the molecular formula C4H8FNO
and a molecular weight of 105.11 g/mol. Its IUPAC name is 3-fluorobutanamide.
Molecular Properties
| Compound Name | 3-fluorobutanamide |
| PubChem CID | 87189810 |
| Molecular Formula | C4H8FNO |
| Molecular Weight | 105.11 g/mol |
| Exact Mass | 105.06 |
| IUPAC Name | 3-fluorobutanamide |
| SMILES | CC(F)CC(N)=O |
| InChI | InChI=1S/C4H8FNO/c1-3(5)2-4(6)7/h3H,2H2,1H3,(H2,6,7) |
| InChIKey | VZDFJBKPSZBWTP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.11 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluorobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluorobutanamide?
The IUPAC name of 3-fluorobutanamide (CID 87189810) is 3-fluorobutanamide.
What is the SMILES notation for 3-fluorobutanamide?
The canonical SMILES for 3-fluorobutanamide is CC(F)CC(N)=O.
What is the InChIKey of 3-fluorobutanamide?
The InChIKey is VZDFJBKPSZBWTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8FNO/c1-3(5)2-4(6)7/h3H,2H2,1H3,(H2,6,7).
What are the key properties of 3-fluorobutanamide?
3-fluorobutanamide has a molecular weight of 105.11 g/mol, XLogP of 0.22, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluorobutanamide is sourced from PubChem (CID 87189810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).