About N,N'-dimethyl-1-(methyliminomethylideneamino)propane-1,3-diamine;hydrochloride
N,N'-dimethyl-1-(methyliminomethylideneamino)propane-1,3-diamine;hydrochloride (PubChem CID 87190299) has the molecular formula C7H17ClN4
and a molecular weight of 192.69 g/mol. Its IUPAC name is N,N'-dimethyl-1-(methyliminomethylideneamino)propane-1,3-diamine;hydrochloride.
Molecular Properties
| Compound Name | N,N'-dimethyl-1-(methyliminomethylideneamino)propane-1,3-diamine;hydrochloride |
| PubChem CID | 87190299 |
| Molecular Formula | C7H17ClN4 |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | N,N'-dimethyl-1-(methyliminomethylideneamino)propane-1,3-diamine;hydrochloride |
| SMILES | CN=C=NC(CCNC)NC.Cl |
| InChI | InChI=1S/C7H16N4.ClH/c1-8-5-4-7(10-3)11-6-9-2;/h7-8,10H,4-5H2,1-3H3;1H |
| InChIKey | BBXONDUKHVDSKR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dimethyl-1-(methyliminomethylideneamino)propane-1,3-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dimethyl-1-(methyliminomethylideneamino)propane-1,3-diamine;hydrochloride?
The IUPAC name of N,N'-dimethyl-1-(methyliminomethylideneamino)propane-1,3-diamine;hydrochloride (CID 87190299) is N,N'-dimethyl-1-(methyliminomethylideneamino)propane-1,3-diamine;hydrochloride.
What is the SMILES notation for N,N'-dimethyl-1-(methyliminomethylideneamino)propane-1,3-diamine;hydrochloride?
The canonical SMILES for N,N'-dimethyl-1-(methyliminomethylideneamino)propane-1,3-diamine;hydrochloride is CN=C=NC(CCNC)NC.Cl.
What is the InChIKey of N,N'-dimethyl-1-(methyliminomethylideneamino)propane-1,3-diamine;hydrochloride?
The InChIKey is BBXONDUKHVDSKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N4.ClH/c1-8-5-4-7(10-3)11-6-9-2;/h7-8,10H,4-5H2,1-3H3;1H.
What are the key properties of N,N'-dimethyl-1-(methyliminomethylideneamino)propane-1,3-diamine;hydrochloride?
N,N'-dimethyl-1-(methyliminomethylideneamino)propane-1,3-diamine;hydrochloride has a molecular weight of 192.69 g/mol, XLogP of 0.37, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dimethyl-1-(methyliminomethylideneamino)propane-1,3-diamine;hydrochloride is sourced from PubChem (CID 87190299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).