C10H10F10 — CID 87190374
1,3-bis(1,1,2,2,2-pentafluoroethyl)cyclohexane (PubChem CID 87190374) has the molecular formula C10H10F10 and a molecular weight of 320.17 g/mol. Its IUPAC name is 1,3-bis(1,1,2,2,2-pentafluoroethyl)cyclohexane.
| Compound Name | 1,3-bis(1,1,2,2,2-pentafluoroethyl)cyclohexane |
|---|---|
| PubChem CID | 87190374 |
| Molecular Formula | C10H10F10 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 1,3-bis(1,1,2,2,2-pentafluoroethyl)cyclohexane |
| SMILES | FC(F)(F)C(F)(F)C1CCCC(C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C10H10F10/c11-7(12,9(15,16)17)5-2-1-3-6(4-5)8(13,14)10(18,19)20/h5-6H,1-4H2 |
| InChIKey | JKSIJLIVHIGTNW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|