About pyrene;2-pyridin-2-yl-1,3-oxazole
pyrene;2-pyridin-2-yl-1,3-oxazole (PubChem CID 87191168) has the molecular formula C24H16N2O
and a molecular weight of 348.41 g/mol. Its IUPAC name is pyrene;2-pyridin-2-yl-1,3-oxazole.
Molecular Properties
| Compound Name | pyrene;2-pyridin-2-yl-1,3-oxazole |
| PubChem CID | 87191168 |
| Molecular Formula | C24H16N2O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | pyrene;2-pyridin-2-yl-1,3-oxazole |
| SMILES | c1cc2ccc3cccc4ccc(c1)c2c34.c1ccc(-c2ncco2)nc1 |
| InChI | InChI=1S/C16H10.C8H6N2O/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-2-4-9-7(3-1)8-10-5-6-11-8/h1-10H;1-6H |
| InChIKey | FBPJHWMUGZDCNZ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyrene;2-pyridin-2-yl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrene;2-pyridin-2-yl-1,3-oxazole?
The IUPAC name of pyrene;2-pyridin-2-yl-1,3-oxazole (CID 87191168) is pyrene;2-pyridin-2-yl-1,3-oxazole.
What is the SMILES notation for pyrene;2-pyridin-2-yl-1,3-oxazole?
The canonical SMILES for pyrene;2-pyridin-2-yl-1,3-oxazole is c1cc2ccc3cccc4ccc(c1)c2c34.c1ccc(-c2ncco2)nc1.
What is the InChIKey of pyrene;2-pyridin-2-yl-1,3-oxazole?
The InChIKey is FBPJHWMUGZDCNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10.C8H6N2O/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-2-4-9-7(3-1)8-10-5-6-11-8/h1-10H;1-6H.
What are the key properties of pyrene;2-pyridin-2-yl-1,3-oxazole?
pyrene;2-pyridin-2-yl-1,3-oxazole has a molecular weight of 348.41 g/mol, XLogP of 6.32, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrene;2-pyridin-2-yl-1,3-oxazole is sourced from PubChem (CID 87191168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).