C11H16F9N3 — CID 87191264
1,4,8-tris(trifluoromethyl)-1,4,8-triazacycloundecane (PubChem CID 87191264) has the molecular formula C11H16F9N3 and a molecular weight of 361.25 g/mol. Its IUPAC name is 1,4,8-tris(trifluoromethyl)-1,4,8-triazacycloundecane.
| Compound Name | 1,4,8-tris(trifluoromethyl)-1,4,8-triazacycloundecane |
|---|---|
| PubChem CID | 87191264 |
| Molecular Formula | C11H16F9N3 |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 1,4,8-tris(trifluoromethyl)-1,4,8-triazacycloundecane |
| SMILES | FC(F)(F)N1CCCN(C(F)(F)F)CCN(C(F)(F)F)CCC1 |
| InChI | InChI=1S/C11H16F9N3/c12-9(13,14)21-3-1-5-22(10(15,16)17)7-8-23(6-2-4-21)11(18,19)20/h1-8H2 |
| InChIKey | PPPCJFBTKORMQW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|