C15H10F6O2 — CID 87191314
2-(4-methylphenyl)-1,3-bis(trifluoromethoxy)benzene (PubChem CID 87191314) has the molecular formula C15H10F6O2 and a molecular weight of 336.23 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1,3-bis(trifluoromethoxy)benzene.
| Compound Name | 2-(4-methylphenyl)-1,3-bis(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 87191314 |
| Molecular Formula | C15H10F6O2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2-(4-methylphenyl)-1,3-bis(trifluoromethoxy)benzene |
| SMILES | Cc1ccc(-c2c(OC(F)(F)F)cccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10F6O2/c1-9-5-7-10(8-6-9)13-11(22-14(16,17)18)3-2-4-12(13)23-15(19,20)21/h2-8H,1H3 |
| InChIKey | XUPUKMLOLQDKBT-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |