C22H26ClN5 — CID 87191329
4-N-[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]-4-N-cyclobutylcyclohexane-1,4-diamine (PubChem CID 87191329) has the molecular formula C22H26ClN5 and a molecular weight of 395.94 g/mol. Its IUPAC name is 4-N-[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]-4-N-cyclobutylcyclohexane-1,4-diamine.
| Compound Name | 4-N-[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]-4-N-cyclobutylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 87191329 |
| Molecular Formula | C22H26ClN5 |
| Molecular Weight | 395.94 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 4-N-[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]-4-N-cyclobutylcyclohexane-1,4-diamine |
| SMILES | NC1CCC(N(c2cc(-c3c[nH]c4ncccc34)cc(Cl)n2)C2CCC2)CC1 |
| InChI | InChI=1S/C22H26ClN5/c23-20-11-14(19-13-26-22-18(19)5-2-10-25-22)12-21(27-20)28(16-3-1-4-16)17-8-6-15(24)7-9-17/h2,5,10-13,15-17H,1,3-4,6-9,24H2,(H,25,26) |
| InChIKey | XFTHKOZNYJPPJO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.94 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|