C26H29ClN6 — CID 87191435
6-chloro-N-[4-[4-(2-methylpropyl)piperazin-1-yl]phenyl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine (PubChem CID 87191435) has the molecular formula C26H29ClN6 and a molecular weight of 461.01 g/mol. Its IUPAC name is 6-chloro-N-[4-[4-(2-methylpropyl)piperazin-1-yl]phenyl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine.
| Compound Name | 6-chloro-N-[4-[4-(2-methylpropyl)piperazin-1-yl]phenyl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 87191435 |
| Molecular Formula | C26H29ClN6 |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 6-chloro-N-[4-[4-(2-methylpropyl)piperazin-1-yl]phenyl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
| SMILES | CC(C)CN1CCN(c2ccc(Nc3cc(-c4c[nH]c5ncccc45)cc(Cl)n3)cc2)CC1 |
| InChI | InChI=1S/C26H29ClN6/c1-18(2)17-32-10-12-33(13-11-32)21-7-5-20(6-8-21)30-25-15-19(14-24(27)31-25)23-16-29-26-22(23)4-3-9-28-26/h3-9,14-16,18H,10-13,17H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | BNTFUNUVTJFBPB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|