C24H24ClN5O2S — CID 87191496
3-[3-[2-chloro-6-(cyclohexylamino)-4-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]benzenesulfonamide (PubChem CID 87191496) has the molecular formula C24H24ClN5O2S and a molecular weight of 482.01 g/mol. Its IUPAC name is 3-[3-[2-chloro-6-(cyclohexylamino)-4-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]benzenesulfonamide.
| Compound Name | 3-[3-[2-chloro-6-(cyclohexylamino)-4-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 87191496 |
| Molecular Formula | C24H24ClN5O2S |
| Molecular Weight | 482.01 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 3-[3-[2-chloro-6-(cyclohexylamino)-4-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(-c2cnc3[nH]cc(-c4cc(Cl)nc(NC5CCCCC5)c4)c3c2)c1 |
| InChI | InChI=1S/C24H24ClN5O2S/c25-22-11-16(12-23(30-22)29-18-6-2-1-3-7-18)21-14-28-24-20(21)10-17(13-27-24)15-5-4-8-19(9-15)33(26,31)32/h4-5,8-14,18H,1-3,6-7H2,(H,27,28)(H,29,30)(H2,26,31,32) |
| InChIKey | KBYZOGXCAAVSSV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.01 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|