C28H27ClN6O4S — CID 87191508
N-[3-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-2-(1,3-dioxoisoindol-2-yl)ethanesulfonamide (PubChem CID 87191508) has the molecular formula C28H27ClN6O4S and a molecular weight of 579.08 g/mol. Its IUPAC name is N-[3-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-2-(1,3-dioxoisoindol-2-yl)ethanesulfonamide.
| Compound Name | N-[3-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-2-(1,3-dioxoisoindol-2-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 87191508 |
| Molecular Formula | C28H27ClN6O4S |
| Molecular Weight | 579.08 g/mol |
| Exact Mass | 578.15 |
| IUPAC Name | N-[3-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-2-(1,3-dioxoisoindol-2-yl)ethanesulfonamide |
| SMILES | O=C1c2ccccc2C(=O)N1CCS(=O)(=O)NC1CCCC(Nc2cc(-c3c[nH]c4ncccc34)cc(Cl)n2)C1 |
| InChI | InChI=1S/C28H27ClN6O4S/c29-24-13-17(23-16-31-26-20(23)9-4-10-30-26)14-25(33-24)32-18-5-3-6-19(15-18)34-40(38,39)12-11-35-27(36)21-7-1-2-8-22(21)28(35)37/h1-2,4,7-10,13-14,16,18-19,34H,3,5-6,11-12,15H2,(H,30,31)(H,32,33) |
| InChIKey | RCINDOUESFUVBG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.08 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|