About 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-chloro-N-cyclohexylpyridin-2-amine
4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-chloro-N-cyclohexylpyridin-2-amine (PubChem CID 87191704) has the molecular formula C18H18BrClN4
and a molecular weight of 405.73 g/mol. Its IUPAC name is 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-chloro-N-cyclohexylpyridin-2-amine.
Molecular Properties
| Compound Name | 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-chloro-N-cyclohexylpyridin-2-amine |
| PubChem CID | 87191704 |
| Molecular Formula | C18H18BrClN4 |
| Molecular Weight | 405.73 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-chloro-N-cyclohexylpyridin-2-amine |
| SMILES | Clc1cc(-c2c[nH]c3ncc(Br)cc23)cc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C18H18BrClN4/c19-12-8-14-15(10-22-18(14)21-9-12)11-6-16(20)24-17(7-11)23-13-4-2-1-3-5-13/h6-10,13H,1-5H2,(H,21,22)(H,23,24) |
| InChIKey | RYVVIXYXRNFWMF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.73 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-chloro-N-cyclohexylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-chloro-N-cyclohexylpyridin-2-amine?
The IUPAC name of 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-chloro-N-cyclohexylpyridin-2-amine (CID 87191704) is 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-chloro-N-cyclohexylpyridin-2-amine.
What is the SMILES notation for 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-chloro-N-cyclohexylpyridin-2-amine?
The canonical SMILES for 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-chloro-N-cyclohexylpyridin-2-amine is Clc1cc(-c2c[nH]c3ncc(Br)cc23)cc(NC2CCCCC2)n1.
What is the InChIKey of 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-chloro-N-cyclohexylpyridin-2-amine?
The InChIKey is RYVVIXYXRNFWMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BrClN4/c19-12-8-14-15(10-22-18(14)21-9-12)11-6-16(20)24-17(7-11)23-13-4-2-1-3-5-13/h6-10,13H,1-5H2,(H,21,22)(H,23,24).
What are the key properties of 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-chloro-N-cyclohexylpyridin-2-amine?
4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-chloro-N-cyclohexylpyridin-2-amine has a molecular weight of 405.73 g/mol, XLogP of 5.79, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-chloro-N-cyclohexylpyridin-2-amine is sourced from PubChem (CID 87191704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).