C27H27ClF2N6O3S — CID 87191751
N-[2-[[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]sulfamoyl]ethyl]-2,4-difluorobenzamide (PubChem CID 87191751) has the molecular formula C27H27ClF2N6O3S and a molecular weight of 589.07 g/mol. Its IUPAC name is N-[2-[[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]sulfamoyl]ethyl]-2,4-difluorobenzamide.
| Compound Name | N-[2-[[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]sulfamoyl]ethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 87191751 |
| Molecular Formula | C27H27ClF2N6O3S |
| Molecular Weight | 589.07 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | N-[2-[[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]sulfamoyl]ethyl]-2,4-difluorobenzamide |
| SMILES | O=C(NCCS(=O)(=O)NC1CCC(Nc2cc(-c3c[nH]c4ncccc34)cc(Cl)n2)CC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C27H27ClF2N6O3S/c28-24-12-16(22-15-33-26-20(22)2-1-9-31-26)13-25(35-24)34-18-4-6-19(7-5-18)36-40(38,39)11-10-32-27(37)21-8-3-17(29)14-23(21)30/h1-3,8-9,12-15,18-19,36H,4-7,10-11H2,(H,31,33)(H,32,37)(H,34,35) |
| InChIKey | YBFPDINJRXAQBS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.07 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|